Fusaric acid
 |
| Names |
| IUPAC name
5-Butylpyridine-2-carboxylic acid
|
Other names
5-Butylpicolinic acid
Fusarinic acid
Picolinic acid, 5-butyl-
|
| Identifiers |
|
|
536-69-6 Y |
| ChemSpider |
3324 N |
| EC Number |
208-643-0 |
| Jmol 3D image |
Interactive graph |
| KEGG |
C10146 N |
| MeSH |
D005669 |
| PubChem |
3442 |
-
InChI=1S/C10H13NO2/c1-2-3-4-8-5-6-9(10(12)13)11-7-8/h5-7H,2-4H2,1H3,(H,12,13) N
Key: DGMPVYSXXIOGJY-UHFFFAOYSA-N N
-
InChI=1/C10H13NO2/c1-2-3-4-8-5-6-9(10(12)13)11-7-8/h5-7H,2-4H2,1H3,(H,12,13)
Key: DGMPVYSXXIOGJY-UHFFFAOYAD
|
|
|
| Properties |
|
|
C10H13NO2 |
| Molar mass |
179.22 g·mol−1 |
| Melting point |
97 to 98 °C (207 to 208 °F; 370 to 371 K) |
| Related compounds |
|
Related compounds
|
picolinic acid |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
N verify (what is Y N ?) |
| Infobox references |
|
|
Fusaric acid is a picolinic acid derivative.
Antibiotic (wilting agent) first isolated from the fungus Fusarium heterosporium.[1]
It is typically isolated from various Fusarium species, and has been proposed for a various therapeutic applications. However, it is primarily used as a research tool.
Its mechanism of action is not well understood. It likely inhibits Dopamine beta-hydroxylase (the enzyme that converts dopamine to norepinephrine). It may also have other actions, such as the inhibition of cell proliferation and DNA synthesis.
It is used to make bupicomide.
References[edit]
- ^ Yabuta et al., J. Agric. Chem. Soc. Jpn. 10, 1059 (1934).
|
|
|
|
|
|
| α1 |
|
|
|
- Antagonists
- Abanoquil
- Adimolol
- Ajmalicine
- Alfuzosin
- Amosulalol
- Anisodamine
- Arotinolol
- Atiprosin
- Atypical antipsychotics (e.g., clozapine, olanzapine, quetiapine, risperidone)
- Benoxathian
- Buflomedil
- Bunazosin
- Carvedilol
- Corynanthine
- Dapiprazole
- Domesticine
- Doxazosin
- Ergolines (e.g., ergotamine, dihydroergotamine, lisuride, terguride)
- Etoperidone
- Eugenodilol
- Fenspiride
- Hydroxyzine
- Indoramin
- Ketanserin
- L-765,314
- Labetalol
- mCPP
- Mepiprazole
- Metazosin
- Monatepil
- Moxisylyte
- Naftopidil
- Nantenine
- Nefazodone
- Neldazosin
- Niaprazine
- Nicergoline
- Niguldipine
- Pardoprunox
- Pelanserin
- Phendioxan
- Phenoxybenzamine
- Phentolamine
- Piperoxan
- Prazosin
- Quinazosin
- Ritanserin
- Silodosin
- Spiperone
- Talipexole
- Tamsulosin
- Terazosin
- Tiodazosin
- Tolazoline
- Trazodone
- Tetracyclic antidepressants (e.g., amoxapine, maprotiline, mianserin)
- Tricyclic antidepressants (e.g., amitriptyline, clomipramine, doxepin, imipramine, trimipramine)
- Trimazosin
- Typical antipsychotics (e.g., chlorpromazine, fluphenazine, loxapine, thioridazine)
- Urapidil
- WB-4101
- Zolertine
|
|
|
| α2 |
|
|
|
- Antagonists
- 1-PP
- Adimolol
- Aptazapine
- Atipamezole
- Atypical antipsychotics (e.g., asenapine, clozapine, lurasidone, paliperidone, quetiapine, risperidone, zotepine)
- Azapirones (e.g., buspirone, tandospirone)
- BRL-44408
- Buflomedil
- Cirazoline
- Efaroxan
- Esmirtazapine
- Fenmetozole
- Fluparoxan
- Idazoxan
- mCPP
- Mianserin
- Mirtazapine
- NAN-190
- Olanzapine
- Pardoprunox
- Phentolamine
- Phenoxybenzamine
- Piperoxan
- Piribedil
- Rauwolscine
- Rotigotine
- SB-269970
- Setiptiline
- Spiroxatrine
- Sunepitron
- Tolazoline
- Typical antipsychotics (e.g., chlorpromazine, fluphenazine, loxapine, thioridazine)
- Yohimbine
|
|
|
| β |
|
|
|
|
|
|
|
| NET |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
- Others
- Antihistamines (e.g., brompheniramine, chlorphenamine, pheniramine, tripelennamine)
- Arylcyclohexylamines (e.g., ketamine, phencyclidine)
- CP-39,332
- EXP-561
- Fezolamine
- Ginkgo biloba
- Indeloxazine
- Loxapine
- Nefazodone
- Nefopam
- Opioids (e.g., methadone, pethidine (meperidine), tapentadol, tramadol, levorphanol)
- Pridefine
- Tedatioxetine
- Teniloxazine
- Tofenacin
- Tropanes (e.g., cocaine)
- Ziprasidone
|
|
|
| VMATs |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| DAT |
| Inhibitors |
|
|
| Enhancers |
|
|
| Modulators |
|
|
|
| VMATs |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
